C16H20NNaO3 — CID 23690649
sodium;3,4-dimethyl-N-phenylcyclohex-3-ene-1-carboxamide;hydroxymethanone (PubChem CID 23690649) has the molecular formula C16H20NNaO3 and a molecular weight of 297.33 g/mol. Its IUPAC name is sodium;3,4-dimethyl-N-phenylcyclohex-3-ene-1-carboxamide;hydroxymethanone.
| Compound Name | sodium;3,4-dimethyl-N-phenylcyclohex-3-ene-1-carboxamide;hydroxymethanone |
|---|---|
| PubChem CID | 23690649 |
| Molecular Formula | C16H20NNaO3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | sodium;3,4-dimethyl-N-phenylcyclohex-3-ene-1-carboxamide;hydroxymethanone |
| SMILES | CC1=C(C)CC(C(=O)Nc2ccccc2)CC1.O=[C-]O.[Na+] |
| InChI | InChI=1S/C15H19NO.CHO2.Na/c1-11-8-9-13(10-12(11)2)15(17)16-14-6-4-3-5-7-14;2-1-3;/h3-7,13H,8-10H2,1-2H3,(H,16,17);(H,2,3);/q;-1;+1 |
| InChIKey | AXSVSZFFLLPCGQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|