C20H27NO — CID 101104319
2-[(1S)-2,2-dimethyl-1-[methyl-[(1R)-1-phenylethyl]amino]propyl]phenol (PubChem CID 101104319) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-[(1S)-2,2-dimethyl-1-[methyl-[(1R)-1-phenylethyl]amino]propyl]phenol.
| Compound Name | 2-[(1S)-2,2-dimethyl-1-[methyl-[(1R)-1-phenylethyl]amino]propyl]phenol |
|---|---|
| PubChem CID | 101104319 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-[(1S)-2,2-dimethyl-1-[methyl-[(1R)-1-phenylethyl]amino]propyl]phenol |
| SMILES | C[C@H](c1ccccc1)N(C)[C@H](c1ccccc1O)C(C)(C)C |
| InChI | InChI=1S/C20H27NO/c1-15(16-11-7-6-8-12-16)21(5)19(20(2,3)4)17-13-9-10-14-18(17)22/h6-15,19,22H,1-5H3/t15-,19-/m1/s1 |
| InChIKey | WSRGLQTXYDVBAP-DNVCBOLYSA-N |
| XLogP | 5.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|