C21H36N2O2 — CID 101105682
(2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-di(piperidin-1-yl)heptane-1,7-dione (PubChem CID 101105682) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-di(piperidin-1-yl)heptane-1,7-dione.
| Compound Name | (2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-di(piperidin-1-yl)heptane-1,7-dione |
|---|---|
| PubChem CID | 101105682 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-di(piperidin-1-yl)heptane-1,7-dione |
| SMILES | C=C(C[C@@H](C)C(=O)N1CCCCC1)[C@H](C)[C@@H](C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H36N2O2/c1-16(15-17(2)20(24)22-11-7-5-8-12-22)18(3)19(4)21(25)23-13-9-6-10-14-23/h17-19H,1,5-15H2,2-4H3/t17-,18+,19-/m1/s1 |
| InChIKey | AZLUBQXXNLMSEH-CEXWTWQISA-N |
| XLogP | 3.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|