C24H46O5Si2 — CID 101106242
tert-butyl-[(2R,3S,4R,5Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enylideneoxolan-3-yl]oxy-dimethylsilane (PubChem CID 101106242) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4R,5Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enylideneoxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,4R,5Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enylideneoxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101106242 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | tert-butyl-[(2R,3S,4R,5Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enylideneoxolan-3-yl]oxy-dimethylsilane |
| SMILES | C=C/C=C1\O[C@H]([C@H]2COC(C)(C)O2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O5Si2/c1-14-15-17-20(28-30(10,11)22(2,3)4)21(29-31(12,13)23(5,6)7)19(26-17)18-16-25-24(8,9)27-18/h14-15,18-21H,1,16H2,2-13H3/b17-15-/t18-,19-,20+,21+/m1/s1 |
| InChIKey | URUBRAVQGLAZMQ-LIRGIQDOSA-N |
| XLogP | 6.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|