C21H40O5Si — CID 11384037
tert-butyl-[(E,1S)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoxy]-dimethylsilane (PubChem CID 11384037) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is tert-butyl-[(E,1S)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11384037 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | tert-butyl-[(E,1S)-1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoxy]-dimethylsilane |
| SMILES | CC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H40O5Si/c1-11-12-13-15(26-27(9,10)19(2,3)4)17-18(25-21(7,8)24-17)16-14-22-20(5,6)23-16/h12-13,15-18H,11,14H2,1-10H3/b13-12+/t15-,16+,17+,18+/m0/s1 |
| InChIKey | WBOBDCGGCOUYMB-GUUFGMMOSA-N |
| XLogP | 5.01 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|