C19H34O4Si — CID 11002735
[(1R,2R,6S,7S)-4,4-dimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11002735) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is [(1R,2R,6S,7S)-4,4-dimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,2R,6S,7S)-4,4-dimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11002735 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(1R,2R,6S,7S)-4,4-dimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1=C[C@@H]2O[C@H](C1)[C@H]1OC(C)(C)O[C@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-11(2)24(12(3)4,13(5)6)23-14-9-15-17-18(16(10-14)20-15)22-19(7,8)21-17/h9,11-13,15-18H,10H2,1-8H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | ZEUVYHUMNUPFKH-XWTMOSNGSA-N |
| XLogP | 4.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|