C16H28O4Si — CID 10990608
trimethyl-[[(1S,2S,6S,7S,10S)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-8-yl]oxy]silane (PubChem CID 10990608) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is trimethyl-[[(1S,2S,6S,7S,10S)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-8-yl]oxy]silane.
| Compound Name | trimethyl-[[(1S,2S,6S,7S,10S)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-8-yl]oxy]silane |
|---|---|
| PubChem CID | 10990608 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | trimethyl-[[(1S,2S,6S,7S,10S)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-8-yl]oxy]silane |
| SMILES | C[C@H]1C=C(O[Si](C)(C)C)[C@@]2(C)O[C@@H]1[C@]1(C)OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H28O4Si/c1-10-9-11(19-21(6,7)8)15(4)13-16(5,12(10)17-15)20-14(2,3)18-13/h9-10,12-13H,1-8H3/t10-,12-,13+,15+,16-/m0/s1 |
| InChIKey | AZHKZJBLWIWZHB-GIRXQMHSSA-N |
| XLogP | 3.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|