C16H28O4Si — CID 11580450
tert-butyl-dimethyl-[[(1'S,5'S,6'R)-spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-yl]methoxy]silane (PubChem CID 11580450) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1'S,5'S,6'R)-spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1'S,5'S,6'R)-spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-yl]methoxy]silane |
|---|---|
| PubChem CID | 11580450 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl-dimethyl-[[(1'S,5'S,6'R)-spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C[C@@H]2O[C@H]1C=CC21OCCO1 |
| InChI | InChI=1S/C16H28O4Si/c1-15(2,3)21(4,5)19-11-12-10-14-16(17-8-9-18-16)7-6-13(12)20-14/h6-7,12-14H,8-11H2,1-5H3/t12-,13+,14+/m1/s1 |
| InChIKey | OVYODFJYKWFUQW-RDBSUJKOSA-N |
| XLogP | 3.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|