C18H32O5Si — CID 11046511
tert-butyl-[[(1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy]-dimethylsilane (PubChem CID 11046511) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11046511 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl-[[(1S,2R,6S,7R)-1-methoxy-4,4,7-trimethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undec-8-en-9-yl]oxy]-dimethylsilane |
| SMILES | CO[C@@]12CC(O[Si](C)(C)C(C)(C)C)=C[C@@](C)(O1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H32O5Si/c1-15(2,3)24(8,9)22-12-10-17(6)13-14(21-16(4,5)20-13)18(11-12,19-7)23-17/h10,13-14H,11H2,1-9H3/t13-,14+,17+,18-/m0/s1 |
| InChIKey | ZQQSDSCYYLWCLK-JFTQMJAMSA-N |
| XLogP | 3.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|