C19H34O5Si — CID 11485534
tert-butyl-[[(1S,2S,5Z,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatricyclo[7.6.0.010,14]pentadec-5-en-2-yl]oxy]-dimethylsilane (PubChem CID 11485534) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,5Z,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatricyclo[7.6.0.010,14]pentadec-5-en-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,5Z,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatricyclo[7.6.0.010,14]pentadec-5-en-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11485534 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | tert-butyl-[[(1S,2S,5Z,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatricyclo[7.6.0.010,14]pentadec-5-en-2-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC/C=C\CC[C@@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C19H34O5Si/c1-18(2,3)25(6,7)24-13-11-9-8-10-12-20-15-14(13)21-17-16(15)22-19(4,5)23-17/h8,10,13-17H,9,11-12H2,1-7H3/b10-8-/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | XXPZIHNSOULNKY-FIXMEEBESA-N |
| XLogP | 3.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|