C23H44O6Si2 — CID 101106245
(2E)-2-[(3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ylidene]acetaldehyde (PubChem CID 101106245) has the molecular formula C23H44O6Si2 and a molecular weight of 472.77 g/mol. Its IUPAC name is (2E)-2-[(3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ylidene]acetaldehyde.
| Compound Name | (2E)-2-[(3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 101106245 |
| Molecular Formula | C23H44O6Si2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (2E)-2-[(3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-ylidene]acetaldehyde |
| SMILES | CC1(C)OC[C@H]([C@H]2O/C(=C/C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H44O6Si2/c1-21(2,3)30(9,10)28-19-16(13-14-24)26-18(17-15-25-23(7,8)27-17)20(19)29-31(11,12)22(4,5)6/h13-14,17-20H,15H2,1-12H3/b16-13+/t17-,18-,19+,20+/m1/s1 |
| InChIKey | RUXGFOKQDIPHCX-BELXZNSDSA-N |
| XLogP | 5.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|