C20H36O6Si — CID 11112155
(Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal (PubChem CID 11112155) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal.
| Compound Name | (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal |
|---|---|
| PubChem CID | 11112155 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H](/C(=C\C=O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H36O6Si/c1-18(2,3)27(8,9)23-12-14(10-11-21)16-17(26-20(6,7)25-16)15-13-22-19(4,5)24-15/h10-11,15-17H,12-13H2,1-9H3/b14-10-/t15-,16-,17-/m1/s1 |
| InChIKey | ATYYULLDHRXJHS-KAWDRADOSA-N |
| XLogP | 3.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|