C33H72O6Si4 — CID 101106250
(3Z)-3-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]propan-1-ol (PubChem CID 101106250) has the molecular formula C33H72O6Si4 and a molecular weight of 677.28 g/mol. Its IUPAC name is (3Z)-3-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]propan-1-ol.
| Compound Name | (3Z)-3-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]propan-1-ol |
|---|---|
| PubChem CID | 101106250 |
| Molecular Formula | C33H72O6Si4 |
| Molecular Weight | 677.28 g/mol |
| Exact Mass | 676.44 |
| IUPAC Name | (3Z)-3-[(3R,4S,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O/C(=C\CCO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H72O6Si4/c1-30(2,3)40(13,14)35-24-26(37-41(15,16)31(4,5)6)27-29(39-43(19,20)33(10,11)12)28(25(36-27)22-21-23-34)38-42(17,18)32(7,8)9/h22,26-29,34H,21,23-24H2,1-20H3/b25-22-/t26-,27-,28+,29+/m1/s1 |
| InChIKey | PZDGHPGDGJHJRR-BRUHGQGOSA-N |
| XLogP | 9.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.28 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|