C38H78O5Si3 — CID 11686251
(Z)-7-[(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-en-1-ol (PubChem CID 11686251) has the molecular formula C38H78O5Si3 and a molecular weight of 699.29 g/mol. Its IUPAC name is (Z)-7-[(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-en-1-ol.
| Compound Name | (Z)-7-[(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 11686251 |
| Molecular Formula | C38H78O5Si3 |
| Molecular Weight | 699.29 g/mol |
| Exact Mass | 698.52 |
| IUPAC Name | (Z)-7-[(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]hept-5-en-1-ol |
| SMILES | CCCCC[C@@H](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C/C=C\CCCCO)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H78O5Si3/c1-17-18-22-25-31(41-44(11,12)36(2,3)4)27-28-33(42-45(13,14)37(5,6)7)34-30-35(43-46(15,16)38(8,9)10)32(40-34)26-23-20-19-21-24-29-39/h20,23,27-28,31-35,39H,17-19,21-22,24-26,29-30H2,1-16H3/b23-20-,28-27+/t31-,32-,33+,34-,35-/m0/s1 |
| InChIKey | NVSKUFNPTOPITL-WYOZUGMYSA-N |
| XLogP | 11.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.29 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|