C19H19Cl2N5 — CID 10110805
N-cyclohexyl-4-[1-(2,4-dichlorophenyl)pyrazol-4-yl]pyrimidin-2-amine (PubChem CID 10110805) has the molecular formula C19H19Cl2N5 and a molecular weight of 388.30 g/mol. Its IUPAC name is N-cyclohexyl-4-[1-(2,4-dichlorophenyl)pyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-4-[1-(2,4-dichlorophenyl)pyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10110805 |
| Molecular Formula | C19H19Cl2N5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-cyclohexyl-4-[1-(2,4-dichlorophenyl)pyrazol-4-yl]pyrimidin-2-amine |
| SMILES | Clc1ccc(-n2cc(-c3ccnc(NC4CCCCC4)n3)cn2)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2N5/c20-14-6-7-18(16(21)10-14)26-12-13(11-23-26)17-8-9-22-19(25-17)24-15-4-2-1-3-5-15/h6-12,15H,1-5H2,(H,22,24,25) |
| InChIKey | UWDHJTVLJKBXOI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |