C9H16O4S — CID 101108832
[(1S,5S)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate (PubChem CID 101108832) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is [(1S,5S)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate.
| Compound Name | [(1S,5S)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101108832 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [(1S,5S)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate |
| SMILES | CCO[C@H]1CC=C[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C9H16O4S/c1-3-12-9-6-4-5-8(9)7-13-14(2,10)11/h4-5,8-9H,3,6-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | KCAGBXVFLWDLLU-IUCAKERBSA-N |
| XLogP | 0.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|