C22H23F3N6O — CID 101109800
4-[4-[4-[(E)-2-aminoethenyl]piperazin-1-yl]phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 101109800) has the molecular formula C22H23F3N6O and a molecular weight of 444.46 g/mol. Its IUPAC name is 4-[4-[4-[(E)-2-aminoethenyl]piperazin-1-yl]phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[(E)-2-aminoethenyl]piperazin-1-yl]phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 101109800 |
| Molecular Formula | C22H23F3N6O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 4-[4-[4-[(E)-2-aminoethenyl]piperazin-1-yl]phenyl]-2-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | N/C=C/N1CCN(c2ccc(-n3cnn(Cc4ccc(C(F)(F)F)cc4)c3=O)cc2)CC1 |
| InChI | InChI=1S/C22H23F3N6O/c23-22(24,25)18-3-1-17(2-4-18)15-31-21(32)30(16-27-31)20-7-5-19(6-8-20)29-13-11-28(10-9-26)12-14-29/h1-10,16H,11-15,26H2/b10-9+ |
| InChIKey | CKGKVTXITGHKBB-MDZDMXLPSA-N |
| XLogP | 2.65 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|