C26H37O9P — CID 101111214
(4-butyl-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)oxymethyl-ethoxyphosphinic acid (PubChem CID 101111214) has the molecular formula C26H37O9P and a molecular weight of 524.55 g/mol. Its IUPAC name is (4-butyl-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)oxymethyl-ethoxyphosphinic acid.
| Compound Name | (4-butyl-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)oxymethyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 101111214 |
| Molecular Formula | C26H37O9P |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (4-butyl-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)oxymethyl-ethoxyphosphinic acid |
| SMILES | CCCCC1(OCP(=O)(O)OCC)COc2ccccc2OCCOCCOc2ccccc2OC1 |
| InChI | InChI=1S/C26H37O9P/c1-3-5-14-26(34-21-36(27,28)35-4-2)19-32-24-12-8-6-10-22(24)30-17-15-29-16-18-31-23-11-7-9-13-25(23)33-20-26/h6-13H,3-5,14-21H2,1-2H3,(H,27,28) |
| InChIKey | MIONFLKLEOYSLM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|