C18H18FNO — CID 101111276
(2R)-2-[(7-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-phenylethanol (PubChem CID 101111276) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is (2R)-2-[(7-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-phenylethanol.
| Compound Name | (2R)-2-[(7-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-phenylethanol |
|---|---|
| PubChem CID | 101111276 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (2R)-2-[(7-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-phenylethanol |
| SMILES | OC[C@H](/N=C1\CCCc2ccc(F)cc21)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO/c19-15-10-9-13-7-4-8-17(16(13)11-15)20-18(12-21)14-5-2-1-3-6-14/h1-3,5-6,9-11,18,21H,4,7-8,12H2/b20-17+/t18-/m0/s1 |
| InChIKey | GACSATKSXPYLMZ-ONZPZFSWSA-N |
| XLogP | 3.68 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|