C26H19NO4 — CID 101112067
4,9-bis(2-methoxyphenyl)benzo[f]isoindole-1,3-dione (PubChem CID 101112067) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4,9-bis(2-methoxyphenyl)benzo[f]isoindole-1,3-dione.
| Compound Name | 4,9-bis(2-methoxyphenyl)benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101112067 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4,9-bis(2-methoxyphenyl)benzo[f]isoindole-1,3-dione |
| SMILES | COc1ccccc1-c1c2c(c(-c3ccccc3OC)c3ccccc13)C(=O)NC2=O |
| InChI | InChI=1S/C26H19NO4/c1-30-19-13-7-5-11-17(19)21-15-9-3-4-10-16(15)22(18-12-6-8-14-20(18)31-2)24-23(21)25(28)27-26(24)29/h3-14H,1-2H3,(H,27,28,29) |
| InChIKey | BRFISXNAPSJGEH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|