C9H11NO3 — CID 101112330
4-[(1S)-1-hydroxy-2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 101112330) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 101112330 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | CNC[C@@H](O)C1=CC(=O)C(=O)C=C1 |
| InChI | InChI=1S/C9H11NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-10,13H,5H2,1H3/t9-/m1/s1 |
| InChIKey | ALSAJHUYRNBHHN-SECBINFHSA-N |
| XLogP | -0.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|