C11H13BrO2 — CID 101113077
5-bromo-2,2-dimethyl-3,4-dihydrochromen-6-ol (PubChem CID 101113077) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 5-bromo-2,2-dimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 5-bromo-2,2-dimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 101113077 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-bromo-2,2-dimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CC1(C)CCc2c(ccc(O)c2Br)O1 |
| InChI | InChI=1S/C11H13BrO2/c1-11(2)6-5-7-9(14-11)4-3-8(13)10(7)12/h3-4,13H,5-6H2,1-2H3 |
| InChIKey | SRRJVJSAHBMDGV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |