C69H84O15 — CID 101114940
3-[4,6-bis[3-[4-phenylmethoxy-3-(phenylmethoxymethyl)butanoyl]oxypropyl]-1,3,5-trioxan-2-yl]propyl 4-phenylmethoxy-3-(phenylmethoxymethyl)butanoate (PubChem CID 101114940) has the molecular formula C69H84O15 and a molecular weight of 1153.42 g/mol. Its IUPAC name is 3-[4,6-bis[3-[4-phenylmethoxy-3-(phenylmethoxymethyl)butanoyl]oxypropyl]-1,3,5-trioxan-2-yl]propyl 4-phenylmethoxy-3-(phenylmethoxymethyl)butanoate.
| Compound Name | 3-[4,6-bis[3-[4-phenylmethoxy-3-(phenylmethoxymethyl)butanoyl]oxypropyl]-1,3,5-trioxan-2-yl]propyl 4-phenylmethoxy-3-(phenylmethoxymethyl)butanoate |
|---|---|
| PubChem CID | 101114940 |
| Molecular Formula | C69H84O15 |
| Molecular Weight | 1153.42 g/mol |
| Exact Mass | 1152.58 |
| IUPAC Name | 3-[4,6-bis[3-[4-phenylmethoxy-3-(phenylmethoxymethyl)butanoyl]oxypropyl]-1,3,5-trioxan-2-yl]propyl 4-phenylmethoxy-3-(phenylmethoxymethyl)butanoate |
| SMILES | O=C(CC(COCc1ccccc1)COCc1ccccc1)OCCCC1OC(CCCOC(=O)CC(COCc2ccccc2)COCc2ccccc2)OC(CCCOC(=O)CC(COCc2ccccc2)COCc2ccccc2)O1 |
| InChI | InChI=1S/C69H84O15/c70-64(40-61(49-73-43-55-22-7-1-8-23-55)50-74-44-56-24-9-2-10-25-56)79-37-19-34-67-82-68(35-20-38-80-65(71)41-62(51-75-45-57-26-11-3-12-27-57)52-76-46-58-28-13-4-14-29-58)84-69(83-67)36-21-39-81-66(72)42-63(53-77-47-59-30-15-5-16-31-59)54-78-48-60-32-17-6-18-33-60/h1-18,22-33,61-63,67-69H,19-21,34-54H2 |
| InChIKey | HGTBQBQJERWSHM-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 161.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1153.42 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|