C20H24N2O2 — CID 101115010
(1S,2R,7S,8R)-8-benzyl-10,15-diazatetracyclo[6.5.2.01,10.02,7]pentadecane-9,14-dione (PubChem CID 101115010) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,2R,7S,8R)-8-benzyl-10,15-diazatetracyclo[6.5.2.01,10.02,7]pentadecane-9,14-dione.
| Compound Name | (1S,2R,7S,8R)-8-benzyl-10,15-diazatetracyclo[6.5.2.01,10.02,7]pentadecane-9,14-dione |
|---|---|
| PubChem CID | 101115010 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1S,2R,7S,8R)-8-benzyl-10,15-diazatetracyclo[6.5.2.01,10.02,7]pentadecane-9,14-dione |
| SMILES | O=C1N2CCC[C@]23C(=O)N[C@]1(Cc1ccccc1)[C@H]1CCCC[C@H]13 |
| InChI | InChI=1S/C20H24N2O2/c23-17-20-11-6-12-22(20)18(24)19(21-17,13-14-7-2-1-3-8-14)15-9-4-5-10-16(15)20/h1-3,7-8,15-16H,4-6,9-13H2,(H,21,23)/t15-,16+,19+,20-/m0/s1 |
| InChIKey | MEKOYMUKOHTVRH-FIYPYCPBSA-N |
| XLogP | 2.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |