C29H26N2O4 — CID 139049635
(1S,7R,10S,11R)-11-benzoyl-8-benzyl-7-hydroxy-10-phenyl-5,8-diazatricyclo[5.2.2.01,5]undecane-6,9-dione (PubChem CID 139049635) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is (1S,7R,10S,11R)-11-benzoyl-8-benzyl-7-hydroxy-10-phenyl-5,8-diazatricyclo[5.2.2.01,5]undecane-6,9-dione.
| Compound Name | (1S,7R,10S,11R)-11-benzoyl-8-benzyl-7-hydroxy-10-phenyl-5,8-diazatricyclo[5.2.2.01,5]undecane-6,9-dione |
|---|---|
| PubChem CID | 139049635 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (1S,7R,10S,11R)-11-benzoyl-8-benzyl-7-hydroxy-10-phenyl-5,8-diazatricyclo[5.2.2.01,5]undecane-6,9-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2ccccc2)[C@]23CCCN2C(=O)[C@@]1(O)N(Cc1ccccc1)C3=O |
| InChI | InChI=1S/C29H26N2O4/c32-25(22-15-8-3-9-16-22)24-23(21-13-6-2-7-14-21)28-17-10-18-30(28)27(34)29(24,35)31(26(28)33)19-20-11-4-1-5-12-20/h1-9,11-16,23-24,35H,10,17-19H2/t23-,24+,28+,29-/m1/s1 |
| InChIKey | JEGDOKHIPYFGGN-WWUUYQERSA-N |
| XLogP | 3.38 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |