C23H22N2O4 — CID 132608335
(8aS)-2-benzyl-8a-(3-oxo-3-phenylpropyl)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione (PubChem CID 132608335) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (8aS)-2-benzyl-8a-(3-oxo-3-phenylpropyl)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione.
| Compound Name | (8aS)-2-benzyl-8a-(3-oxo-3-phenylpropyl)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione |
|---|---|
| PubChem CID | 132608335 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (8aS)-2-benzyl-8a-(3-oxo-3-phenylpropyl)-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione |
| SMILES | O=C(CC[C@]12CCCN1C(=O)C(=O)N(Cc1ccccc1)C2=O)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O4/c26-19(18-10-5-2-6-11-18)12-14-23-13-7-15-25(23)21(28)20(27)24(22(23)29)16-17-8-3-1-4-9-17/h1-6,8-11H,7,12-16H2/t23-/m0/s1 |
| InChIKey | RFHRKCZNMYYUMH-QHCPKHFHSA-N |
| XLogP | 2.58 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|