C20H21N3O6 — CID 132608337
(8aS)-2-benzyl-8a-[3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione (PubChem CID 132608337) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is (8aS)-2-benzyl-8a-[3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione.
| Compound Name | (8aS)-2-benzyl-8a-[3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione |
|---|---|
| PubChem CID | 132608337 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (8aS)-2-benzyl-8a-[3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-1,3,4-trione |
| SMILES | O=C(CC[C@]12CCCN1C(=O)C(=O)N(Cc1ccccc1)C2=O)N1CCOC1=O |
| InChI | InChI=1S/C20H21N3O6/c24-15(21-11-12-29-19(21)28)7-9-20-8-4-10-23(20)17(26)16(25)22(18(20)27)13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2/t20-/m0/s1 |
| InChIKey | AZXIOFBPUXKFEF-FQEVSTJZSA-N |
| XLogP | 0.68 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|