About 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene
3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene (PubChem CID 142032857) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene.
Molecular Properties
| Compound Name | 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene |
| PubChem CID | 142032857 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene |
| SMILES | Cc1ccccc1.O=C(CCC1CCNCC1)N1CCOC1=O |
| InChI | InChI=1S/C11H18N2O3.C7H8/c14-10(13-7-8-16-11(13)15)2-1-9-3-5-12-6-4-9;1-7-5-3-2-4-6-7/h9,12H,1-8H2;2-6H,1H3 |
| InChIKey | QIAAUHZBRUGAPC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene?
The IUPAC name of 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene (CID 142032857) is 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene.
What is the SMILES notation for 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene?
The canonical SMILES for 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene is Cc1ccccc1.O=C(CCC1CCNCC1)N1CCOC1=O.
What is the InChIKey of 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene?
The InChIKey is QIAAUHZBRUGAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3.C7H8/c14-10(13-7-8-16-11(13)15)2-1-9-3-5-12-6-4-9;1-7-5-3-2-4-6-7/h9,12H,1-8H2;2-6H,1H3.
What are the key properties of 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene?
3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene has a molecular weight of 318.42 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-piperidin-4-ylpropanoyl)-1,3-oxazolidin-2-one;toluene is sourced from PubChem (CID 142032857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).