C17H22N2O3 — CID 126783693
5-[3-(oxan-4-yl)propanoyl]-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 126783693) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-[3-(oxan-4-yl)propanoyl]-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | 5-[3-(oxan-4-yl)propanoyl]-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 126783693 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-[3-(oxan-4-yl)propanoyl]-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | O=C1CCN(C(=O)CCC2CCOCC2)c2ccccc2N1 |
| InChI | InChI=1S/C17H22N2O3/c20-16-7-10-19(15-4-2-1-3-14(15)18-16)17(21)6-5-13-8-11-22-12-9-13/h1-4,13H,5-12H2,(H,18,20) |
| InChIKey | SNJZCVCLFXYPBA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |