C12H13ClN2O2 — CID 4012967
5-(3-chloropropanoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 4012967) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-(3-chloropropanoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | 5-(3-chloropropanoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 4012967 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-(3-chloropropanoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | O=C1CCN(C(=O)CCCl)c2ccccc2N1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-7-5-12(17)15-8-6-11(16)14-9-3-1-2-4-10(9)15/h1-4H,5-8H2,(H,14,16) |
| InChIKey | YOBHYJUVYSIBOA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|