C18H23NO3 — CID 144509444
3-(4-methylcyclohex-3-ene-1-carbonyl)-1,3-oxazolidin-2-one;toluene (PubChem CID 144509444) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(4-methylcyclohex-3-ene-1-carbonyl)-1,3-oxazolidin-2-one;toluene.
| Compound Name | 3-(4-methylcyclohex-3-ene-1-carbonyl)-1,3-oxazolidin-2-one;toluene |
|---|---|
| PubChem CID | 144509444 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-(4-methylcyclohex-3-ene-1-carbonyl)-1,3-oxazolidin-2-one;toluene |
| SMILES | CC1=CCC(C(=O)N2CCOC2=O)CC1.Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO3.C7H8/c1-8-2-4-9(5-3-8)10(13)12-6-7-15-11(12)14;1-7-5-3-2-4-6-7/h2,9H,3-7H2,1H3;2-6H,1H3 |
| InChIKey | VORZJGLBWCUJFJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|