C18H23BN2O3 — CID 142033431
4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]borinane-1-carbonitrile;toluene (PubChem CID 142033431) has the molecular formula C18H23BN2O3 and a molecular weight of 326.20 g/mol. Its IUPAC name is 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]borinane-1-carbonitrile;toluene.
| Compound Name | 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]borinane-1-carbonitrile;toluene |
|---|---|
| PubChem CID | 142033431 |
| Molecular Formula | C18H23BN2O3 |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 4-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]borinane-1-carbonitrile;toluene |
| SMILES | Cc1ccccc1.N#CB1CCC(CC(=O)N2CCOC2=O)CC1 |
| InChI | InChI=1S/C11H15BN2O3.C7H8/c13-8-12-3-1-9(2-4-12)7-10(15)14-5-6-17-11(14)16;1-7-5-3-2-4-6-7/h9H,1-7H2;2-6H,1H3 |
| InChIKey | ARWDPVMNDBPSND-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|