C21H20O3 — CID 56839059
(1S,5S)-7-benzoyl-1-hydroxy-6-phenylbicyclo[3.2.1]octan-8-one (PubChem CID 56839059) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (1S,5S)-7-benzoyl-1-hydroxy-6-phenylbicyclo[3.2.1]octan-8-one.
| Compound Name | (1S,5S)-7-benzoyl-1-hydroxy-6-phenylbicyclo[3.2.1]octan-8-one |
|---|---|
| PubChem CID | 56839059 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (1S,5S)-7-benzoyl-1-hydroxy-6-phenylbicyclo[3.2.1]octan-8-one |
| SMILES | O=C(c1ccccc1)C1C(c2ccccc2)[C@@H]2CCC[C@@]1(O)C2=O |
| InChI | InChI=1S/C21H20O3/c22-19(15-10-5-2-6-11-15)18-17(14-8-3-1-4-9-14)16-12-7-13-21(18,24)20(16)23/h1-6,8-11,16-18,24H,7,12-13H2/t16-,17?,18?,21-/m0/s1 |
| InChIKey | AEPUIYUAKGIJCM-RJPLPAITSA-N |
| XLogP | 3.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |