C20H19BrClN3O5S — CID 101116898
N-[2-[(3aS,6aR)-3-(4-bromophenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide (PubChem CID 101116898) has the molecular formula C20H19BrClN3O5S and a molecular weight of 528.81 g/mol. Its IUPAC name is N-[2-[(3aS,6aR)-3-(4-bromophenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[2-[(3aS,6aR)-3-(4-bromophenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 101116898 |
| Molecular Formula | C20H19BrClN3O5S |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | N-[2-[(3aS,6aR)-3-(4-bromophenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide |
| SMILES | CN1C(=O)[C@@H]2ON(CCNS(=O)(=O)c3ccc(Cl)cc3)C(c3ccc(Br)cc3)[C@@H]2C1=O |
| InChI | InChI=1S/C20H19BrClN3O5S/c1-24-19(26)16-17(12-2-4-13(21)5-3-12)25(30-18(16)20(24)27)11-10-23-31(28,29)15-8-6-14(22)7-9-15/h2-9,16-18,23H,10-11H2,1H3/t16-,17?,18+/m0/s1 |
| InChIKey | NGQKEUSCNHHOJU-PXKIYYGHSA-N |
| XLogP | 2.35 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|