C21H22ClN3O6S — CID 11329102
N-[2-[(3aS,6aR)-3-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide (PubChem CID 11329102) has the molecular formula C21H22ClN3O6S and a molecular weight of 479.94 g/mol. Its IUPAC name is N-[2-[(3aS,6aR)-3-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[2-[(3aS,6aR)-3-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 11329102 |
| Molecular Formula | C21H22ClN3O6S |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | N-[2-[(3aS,6aR)-3-(4-methoxyphenyl)-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide |
| SMILES | COc1ccc(C2[C@@H]3C(=O)N(C)C(=O)[C@@H]3ON2CCNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H22ClN3O6S/c1-24-20(26)17-18(13-3-7-15(30-2)8-4-13)25(31-19(17)21(24)27)12-11-23-32(28,29)16-9-5-14(22)6-10-16/h3-10,17-19,23H,11-12H2,1-2H3/t17-,18?,19+/m0/s1 |
| InChIKey | CQFZXHVXUHBDDT-LJJQOFDWSA-N |
| XLogP | 1.60 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|