C20H21ClN4O5S — CID 101116900
N-[2-[(3aS,6aR)-5-methyl-4,6-dioxo-3-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide (PubChem CID 101116900) has the molecular formula C20H21ClN4O5S and a molecular weight of 464.93 g/mol. Its IUPAC name is N-[2-[(3aS,6aR)-5-methyl-4,6-dioxo-3-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[2-[(3aS,6aR)-5-methyl-4,6-dioxo-3-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 101116900 |
| Molecular Formula | C20H21ClN4O5S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[2-[(3aS,6aR)-5-methyl-4,6-dioxo-3-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]ethyl]-4-chlorobenzenesulfonamide |
| SMILES | CN1C(=O)[C@@H]2ON(CCNS(=O)(=O)c3ccc(Cl)cc3)C(/C=C/c3ccc[nH]3)[C@@H]2C1=O |
| InChI | InChI=1S/C20H21ClN4O5S/c1-24-19(26)17-16(9-6-14-3-2-10-22-14)25(30-18(17)20(24)27)12-11-23-31(28,29)15-7-4-13(21)5-8-15/h2-10,16-18,22-23H,11-12H2,1H3/b9-6+/t16?,17-,18+/m0/s1 |
| InChIKey | KIQCXJWQAWBZEU-PWQCLADFSA-N |
| XLogP | 1.26 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|