C45H66O3S — CID 101117466
2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)-[4-(10-sulfanyldecoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 101117466) has the molecular formula C45H66O3S and a molecular weight of 687.09 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)-[4-(10-sulfanyldecoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)-[4-(10-sulfanyldecoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 101117466 |
| Molecular Formula | C45H66O3S |
| Molecular Weight | 687.09 g/mol |
| Exact Mass | 686.47 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)-[4-(10-sulfanyldecoxy)phenyl]methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=C(c2ccc(OCCCCCCCCCCS)cc2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C45H66O3S/c1-42(2,3)35-27-32(28-36(40(35)46)43(4,5)6)39(33-29-37(44(7,8)9)41(47)38(30-33)45(10,11)12)31-21-23-34(24-22-31)48-25-19-17-15-13-14-16-18-20-26-49/h21-24,27-30,46,49H,13-20,25-26H2,1-12H3 |
| InChIKey | QGYIBOVTICZQJD-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.09 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|