C20H32N2O3S — CID 102288369
1-N,3-N-ditert-butyl-5-(4-sulfanylbutoxy)benzene-1,3-dicarboxamide (PubChem CID 102288369) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is 1-N,3-N-ditert-butyl-5-(4-sulfanylbutoxy)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-ditert-butyl-5-(4-sulfanylbutoxy)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 102288369 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-N,3-N-ditert-butyl-5-(4-sulfanylbutoxy)benzene-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(OCCCCS)cc(C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C20H32N2O3S/c1-19(2,3)21-17(23)14-11-15(18(24)22-20(4,5)6)13-16(12-14)25-9-7-8-10-26/h11-13,26H,7-10H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | DTRLILIILDMFIK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|