C14H10Na2O6 — CID 101117677
disodium;2-(9,10-dioxatricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraen-1-ylmethyl)propanedioate (PubChem CID 101117677) has the molecular formula C14H10Na2O6 and a molecular weight of 320.21 g/mol. Its IUPAC name is disodium;2-(9,10-dioxatricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraen-1-ylmethyl)propanedioate.
| Compound Name | disodium;2-(9,10-dioxatricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraen-1-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 101117677 |
| Molecular Formula | C14H10Na2O6 |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | disodium;2-(9,10-dioxatricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraen-1-ylmethyl)propanedioate |
| SMILES | O=C([O-])C(CC12C=CC(OO1)c1ccccc12)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H12O6.2Na/c15-12(16)9(13(17)18)7-14-6-5-11(19-20-14)8-3-1-2-4-10(8)14;;/h1-6,9,11H,7H2,(H,15,16)(H,17,18);;/q;2*+1/p-2 |
| InChIKey | BHMCXCCCSZURLM-UHFFFAOYSA-L |
| XLogP | -7.03 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | -7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|