C9H14F2O4 — CID 101117701
(3aR,4S,6aR)-4-fluoro-4-[(S)-fluoro(methoxy)methyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole (PubChem CID 101117701) has the molecular formula C9H14F2O4 and a molecular weight of 224.20 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-fluoro-4-[(S)-fluoro(methoxy)methyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4S,6aR)-4-fluoro-4-[(S)-fluoro(methoxy)methyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 101117701 |
| Molecular Formula | C9H14F2O4 |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (3aR,4S,6aR)-4-fluoro-4-[(S)-fluoro(methoxy)methyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
| SMILES | CO[C@@H](F)[C@]1(F)OC[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C9H14F2O4/c1-8(2)14-5-4-13-9(11,6(5)15-8)7(10)12-3/h5-7H,4H2,1-3H3/t5-,6-,7-,9-/m1/s1 |
| InChIKey | QAAXVKFGUIODRW-JXOAFFINSA-N |
| XLogP | 1.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |