C10H15F3O5 — CID 11747693
(3aS,6S,7S,7aS)-6-methoxy-2,2-dimethyl-7-(trifluoromethyl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 11747693) has the molecular formula C10H15F3O5 and a molecular weight of 272.22 g/mol. Its IUPAC name is (3aS,6S,7S,7aS)-6-methoxy-2,2-dimethyl-7-(trifluoromethyl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aS,6S,7S,7aS)-6-methoxy-2,2-dimethyl-7-(trifluoromethyl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 11747693 |
| Molecular Formula | C10H15F3O5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (3aS,6S,7S,7aS)-6-methoxy-2,2-dimethyl-7-(trifluoromethyl)-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CO[C@H]1OC[C@@H]2OC(C)(C)O[C@@H]2[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O5/c1-8(2)17-5-4-16-7(15-3)9(14,6(5)18-8)10(11,12)13/h5-7,14H,4H2,1-3H3/t5-,6-,7-,9-/m0/s1 |
| InChIKey | CCSWQDJYMBHJQC-AZRUVXNYSA-N |
| XLogP | 0.80 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |