About [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide
[2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide (PubChem CID 101120030) has the molecular formula C7H6ClN
and a molecular weight of 139.58 g/mol. Its IUPAC name is [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide.
Molecular Properties
| Compound Name | [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide |
| PubChem CID | 101120030 |
| Molecular Formula | C7H6ClN |
| Molecular Weight | 139.58 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide |
| SMILES | [N-]=C1C=C[CH+]C=C1CCl |
| InChI | InChI=1S/C7H6ClN/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | FDOJRHDSBODJGJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
The IUPAC name of [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide (CID 101120030) is [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide.
What is the SMILES notation for [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
The canonical SMILES for [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide is [N-]=C1C=C[CH+]C=C1CCl.
What is the InChIKey of [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
The InChIKey is FDOJRHDSBODJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2.
What are the key properties of [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
[2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide has a molecular weight of 139.58 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide is sourced from PubChem (CID 101120030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).