About [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide
[2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide (PubChem CID 11769270) has the molecular formula C8H7Cl2N
and a molecular weight of 188.06 g/mol. Its IUPAC name is [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide.
Molecular Properties
| Compound Name | [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide |
| PubChem CID | 11769270 |
| Molecular Formula | C8H7Cl2N |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide |
| SMILES | [N-]=C1C(CCl)=C[CH+]C=C1CCl |
| InChI | InChI=1S/C8H7Cl2N/c9-4-6-2-1-3-7(5-10)8(6)11/h1-3H,4-5H2 |
| InChIKey | XWRUGVFMIMMDEM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
The IUPAC name of [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide (CID 11769270) is [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide.
What is the SMILES notation for [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
The canonical SMILES for [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide is [N-]=C1C(CCl)=C[CH+]C=C1CCl.
What is the InChIKey of [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
The InChIKey is XWRUGVFMIMMDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2N/c9-4-6-2-1-3-7(5-10)8(6)11/h1-3H,4-5H2.
What are the key properties of [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide?
[2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide has a molecular weight of 188.06 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-ylidene]azanide is sourced from PubChem (CID 11769270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).