C8H8Cl2N+ — CID 101120032
2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-imine (PubChem CID 101120032) has the molecular formula C8H8Cl2N+ and a molecular weight of 189.06 g/mol. Its IUPAC name is 2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-imine.
| Compound Name | 2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 101120032 |
| Molecular Formula | C8H8Cl2N+ |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | 2,6-bis(chloromethyl)cyclohexa-2,5-dien-1-imine |
| SMILES | [H]N=C1C(CCl)=C[CH+]C=C1CCl |
| InChI | InChI=1S/C8H8Cl2N/c9-4-6-2-1-3-7(5-10)8(6)11/h1-3,11H,4-5H2/q+1 |
| InChIKey | MLOFMCSAEFCNGK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|