C8H7Cl2N — CID 10965259
(6E)-2-(chloromethyl)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 10965259) has the molecular formula C8H7Cl2N and a molecular weight of 188.06 g/mol. Its IUPAC name is (6E)-2-(chloromethyl)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-2-(chloromethyl)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 10965259 |
| Molecular Formula | C8H7Cl2N |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | (6E)-2-(chloromethyl)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C(CCl)=CC=C\C1=C/Cl |
| InChI | InChI=1S/C8H7Cl2N/c9-4-6-2-1-3-7(5-10)8(6)11/h1-4,11H,5H2/b6-4+,11-8- |
| InChIKey | GUXWMHKTSHRQGF-NBUPAEHBSA-N |
| XLogP | 2.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|