C13H14O7S — CID 101120292
1-ethenoxy-1,4-dioxo-4-phenylmethoxybutane-2-sulfonic acid (PubChem CID 101120292) has the molecular formula C13H14O7S and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-ethenoxy-1,4-dioxo-4-phenylmethoxybutane-2-sulfonic acid.
| Compound Name | 1-ethenoxy-1,4-dioxo-4-phenylmethoxybutane-2-sulfonic acid |
|---|---|
| PubChem CID | 101120292 |
| Molecular Formula | C13H14O7S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-ethenoxy-1,4-dioxo-4-phenylmethoxybutane-2-sulfonic acid |
| SMILES | C=COC(=O)C(CC(=O)OCc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C13H14O7S/c1-2-19-13(15)11(21(16,17)18)8-12(14)20-9-10-6-4-3-5-7-10/h2-7,11H,1,8-9H2,(H,16,17,18) |
| InChIKey | FXEABFNWNXVBMH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|