C16H26NO12P — CID 101121087
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(dimethoxyphosphorylamino)oxan-2-yl]methyl acetate (PubChem CID 101121087) has the molecular formula C16H26NO12P and a molecular weight of 455.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(dimethoxyphosphorylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(dimethoxyphosphorylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101121087 |
| Molecular Formula | C16H26NO12P |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(dimethoxyphosphorylamino)oxan-2-yl]methyl acetate |
| SMILES | COP(=O)(N[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)OC |
| InChI | InChI=1S/C16H26NO12P/c1-8(18)25-7-12-13(26-9(2)19)14(27-10(3)20)15(28-11(4)21)16(29-12)17-30(22,23-5)24-6/h12-16H,7H2,1-6H3,(H,17,22)/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | NIJRFIZVEOOKPL-IBEHDNSVSA-N |
| XLogP | 0.06 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|