C14H20O2 — CID 101122180
(4R,4aS)-4,4a-dimethyl-6-propan-2-ylidene-3,4,5,7-tetrahydrochromen-2-one (PubChem CID 101122180) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4R,4aS)-4,4a-dimethyl-6-propan-2-ylidene-3,4,5,7-tetrahydrochromen-2-one.
| Compound Name | (4R,4aS)-4,4a-dimethyl-6-propan-2-ylidene-3,4,5,7-tetrahydrochromen-2-one |
|---|---|
| PubChem CID | 101122180 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (4R,4aS)-4,4a-dimethyl-6-propan-2-ylidene-3,4,5,7-tetrahydrochromen-2-one |
| SMILES | CC(C)=C1CC=C2OC(=O)C[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C14H20O2/c1-9(2)11-5-6-12-14(4,8-11)10(3)7-13(15)16-12/h6,10H,5,7-8H2,1-4H3/t10-,14+/m1/s1 |
| InChIKey | BGDKGMPMBUNYIU-YGRLFVJLSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|