C26H38O3 — CID 90871489
7,7-dimethyl-3,3,4a-tris(3-methylbut-2-enyl)-5,6-dihydrochromene-2,4-dione (PubChem CID 90871489) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is 7,7-dimethyl-3,3,4a-tris(3-methylbut-2-enyl)-5,6-dihydrochromene-2,4-dione.
| Compound Name | 7,7-dimethyl-3,3,4a-tris(3-methylbut-2-enyl)-5,6-dihydrochromene-2,4-dione |
|---|---|
| PubChem CID | 90871489 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 7,7-dimethyl-3,3,4a-tris(3-methylbut-2-enyl)-5,6-dihydrochromene-2,4-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)OC2=CC(C)(C)CCC2(CC=C(C)C)C1=O |
| InChI | InChI=1S/C26H38O3/c1-18(2)9-12-25-16-15-24(7,8)17-21(25)29-23(28)26(22(25)27,13-10-19(3)4)14-11-20(5)6/h9-11,17H,12-16H2,1-8H3 |
| InChIKey | JUNDTCVCHOIWLW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|