C19H18O5 — CID 101125202
dimethyl 9-oxahexacyclo[8.6.0.02,12.03,8.011,13.014,16]hexadeca-3,5,7-triene-10,11-dicarboxylate (PubChem CID 101125202) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is dimethyl 9-oxahexacyclo[8.6.0.02,12.03,8.011,13.014,16]hexadeca-3,5,7-triene-10,11-dicarboxylate.
| Compound Name | dimethyl 9-oxahexacyclo[8.6.0.02,12.03,8.011,13.014,16]hexadeca-3,5,7-triene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 101125202 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | dimethyl 9-oxahexacyclo[8.6.0.02,12.03,8.011,13.014,16]hexadeca-3,5,7-triene-10,11-dicarboxylate |
| SMILES | COC(=O)C12Oc3ccccc3C3C1C1CC1C1C3C12C(=O)OC |
| InChI | InChI=1S/C19H18O5/c1-22-16(20)18-14-10-7-9(10)13-12(15(14)18)8-5-3-4-6-11(8)24-19(13,18)17(21)23-2/h3-6,9-10,12-15H,7H2,1-2H3 |
| InChIKey | SWEANEPATCUIHK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |